ChemNet > CAS > 68818-86-0 9,10-Diethoxyanthracene
68818-86-0 9,10-Diethoxyanthracene
| Nome del prodotto |
9,10-Diethoxyanthracene |
| Nome inglese |
9,10-Diethoxyanthracene;Anthracene, 9,10-diethoxy- |
| Formula molecolare |
C18H18O2 |
| Peso Molecolare |
266.3343 |
| InChI |
InChI=1/C18H18O2/c1-3-19-17-13-9-5-7-11-15(13)18(20-4-2)16-12-8-6-10-14(16)17/h5-12H,3-4H2,1-2H3 |
| Numero CAS |
68818-86-0 |
| EINECS |
272-401-0 |
| Struttura molecolare |
|
| Densità |
1.115g/cm3 |
| Punto di fusione |
148-151℃ |
| Punto di ebollizione |
433.2°C at 760 mmHg |
| Indice di rifrazione |
1.626 |
| Punto d'infiammabilità |
176.4°C |
| Pressione di vapore |
2.65E-07mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|