ChemNet > CAS > 6926-51-8 5-(4-Methoxyphenyl)-1H-tetrazole
6926-51-8 5-(4-Methoxyphenyl)-1H-tetrazole
| Nome del prodotto |
5-(4-Methoxyphenyl)-1H-tetrazole |
| Nome inglese |
5-(4-Methoxyphenyl)-1H-tetrazole;5-(4-methoxyphenyl)-2H-tetrazole |
| Formula molecolare |
C8H8N4O |
| Peso Molecolare |
176.1753 |
| InChI |
InChI=1/C8H8N4O/c1-13-7-4-2-6(3-5-7)8-9-11-12-10-8/h2-5H,1H3,(H,9,10,11,12) |
| Numero CAS |
6926-51-8 |
| Struttura molecolare |
|
| Densità |
1.288g/cm3 |
| Punto di ebollizione |
365.2°C at 760 mmHg |
| Indice di rifrazione |
1.591 |
| Punto d'infiammabilità |
133.2°C |
| Pressione di vapore |
1.6E-05mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
