ChemNet > CAS > 69321-60-4 2,6-Dibromotoluene
69321-60-4 2,6-Dibromotoluene
| Nome del prodotto |
2,6-Dibromotoluene |
| Nome inglese |
2,6-Dibromotoluene; 1,3-dibromo-2-methylbenzene |
| Formula molecolare |
C7H6Br2 |
| Peso Molecolare |
249.9305 |
| InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| Numero CAS |
69321-60-4 |
| Struttura molecolare |
|
| Densità |
1.81g/cm3 |
| Punto di ebollizione |
246°C at 760 mmHg |
| Indice di rifrazione |
1.587 |
| Punto d'infiammabilità |
106.6°C |
| Pressione di vapore |
0.0436mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
