711-79-5 2-Acetyl-1-naphthol
| Nome del prodotto |
2-Acetyl-1-naphthol |
| Nome inglese |
2-Acetyl-1-naphthol; 1-Hydroxy-2-acetonaphthone; 2-Acetyl-1-hydroxynaphthalene |
| Formula molecolare |
C12H10O2 |
| Peso Molecolare |
186.2066 |
| InChI |
InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
| Numero CAS |
711-79-5 |
| EINECS |
211-918-8 |
| Struttura molecolare |
|
| Densità |
1.213g/cm3 |
| Punto di fusione |
97-100℃ |
| Punto di ebollizione |
334.9°C at 760 mmHg |
| Indice di rifrazione |
1.65 |
| Punto d'infiammabilità |
142.4°C |
| Pressione di vapore |
6.37E-05mmHg at 25°C |
| Simboli di pericolo |
Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|