ChemNet > CAS > 72235-55-3 3-Chloro-2-fluorobenzylamine
72235-55-3 3-Chloro-2-fluorobenzylamine
| Nome del prodotto |
3-Chloro-2-fluorobenzylamine |
| Nome inglese |
3-Chloro-2-fluorobenzylamine; 1-(3-chloro-2-fluorophenyl)methanamine |
| Formula molecolare |
C7H7ClFN |
| Peso Molecolare |
159.5886 |
| InChI |
InChI=1/C7H7ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
| Numero CAS |
72235-55-3 |
| Struttura molecolare |
|
| Densità |
1.27g/cm3 |
| Punto di ebollizione |
219.6°C at 760 mmHg |
| Indice di rifrazione |
1.543 |
| Punto d'infiammabilità |
86.6°C |
| Pressione di vapore |
0.119mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
