ChemNet > CAS > 14602-86-9;7635-53-2 (1R)-(-)-menthyl chloroformate
14602-86-9;7635-53-2 (1R)-(-)-menthyl chloroformate
| Nome del prodotto |
(1R)-(-)-menthyl chloroformate |
| Nome inglese |
(1R)-(-)-menthyl chloroformate; L-p-menth-3-yl chloroformate; Chloroformic acid (1R)-menthyl ester; L-Menthyl chloroformate; (1R)-(-)-menethyl chloroformate; 5-methyl-2-(propan-2-yl)cyclohexyl carbonochloridate; (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl chlorocarbonate; Carbonochloridic acid,(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester; Carbonochloridicacid, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-(1a,2b,5a)]-; (-)-(1R)-Menthyl chloroformate; (-)-(1R,2S,5R)-Menthyl chloroformate; (-)-(R)-Menthyl chloroformate; (-)-Menthyl chloroformate; (1R,2S,5R)-Menthylchloroformate; Chlorocarbonic acid (-)-menthyl ester; L-(-)-Menthylchloroformate; L-Menthoxy chloroformate; L-Menthyl chloroformate; Menthylchloroformate |
| Formula molecolare |
C11H19ClO2 |
| Peso Molecolare |
218.7204 |
| InChI |
InChI=1/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| Numero CAS |
14602-86-9;7635-53-2 |
| Struttura molecolare |
|
| Densità |
1.04g/cm3 |
| Punto di ebollizione |
233.9°C at 760 mmHg |
| Indice di rifrazione |
1.462 |
| Punto d'infiammabilità |
70°C |
| Pressione di vapore |
0.0546mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R23:Toxic by inhalation.;
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
