ChemNet > CAS > 782-17-2 2-(4-Fluorophenyl)indole
782-17-2 2-(4-Fluorophenyl)indole
| Nome del prodotto |
2-(4-Fluorophenyl)indole |
| Nome inglese |
2-(4-Fluorophenyl)indole; 2-(naphth-2-yl)-1h-indole; 2-(4-fluorophenyl)-1H-indole; 6-(4-fluorophenyl)-1H-indole |
| Formula molecolare |
C14H10FN |
| Peso Molecolare |
211.2343 |
| InChI |
InChI=1/C14H10FN/c15-13-5-3-10(4-6-13)12-2-1-11-7-8-16-14(11)9-12/h1-9,16H |
| Numero CAS |
782-17-2 |
| Struttura molecolare |
|
| Densità |
1.233g/cm3 |
| Punto di fusione |
190-192℃ |
| Punto di ebollizione |
389.094°C at 760 mmHg |
| Indice di rifrazione |
1.658 |
| Punto d'infiammabilità |
189.118°C |
| Pressione di vapore |
0mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
