ChemNet > CAS > 79636-94-5 5-Bromo-2-ethoxybenzaldehyde
79636-94-5 5-Bromo-2-ethoxybenzaldehyde
| Nome del prodotto |
5-Bromo-2-ethoxybenzaldehyde |
| Nome inglese |
5-Bromo-2-ethoxybenzaldehyde; |
| Formula molecolare |
C9H9BrO2 |
| Peso Molecolare |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-6H,2H2,1H3 |
| Numero CAS |
79636-94-5 |
| Struttura molecolare |
|
| Densità |
1.451g/cm3 |
| Punto di fusione |
68℃ |
| Punto di ebollizione |
302.7°C at 760 mmHg |
| Indice di rifrazione |
1.573 |
| Punto d'infiammabilità |
136.9°C |
| Pressione di vapore |
0.000974mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
