ChemNet > CAS > 81321-10-0 metil-3-isotiocianatotiofene-2-carbossilato
81321-10-0 metil-3-isotiocianatotiofene-2-carbossilato
| Nome del prodotto |
metil-3-isotiocianatotiofene-2-carbossilato |
| Nome inglese |
methyl 3-isothiocyanatothiophene-2-carboxylate; |
| Formula molecolare |
C7H5NO2S2 |
| Peso Molecolare |
199.2501 |
| InChI |
InChI=1/C7H5NO2S2/c1-10-7(9)6-5(8-4-11)2-3-12-6/h2-3H,1H3 |
| Numero CAS |
81321-10-0 |
| Struttura molecolare |
|
| Densità |
1.35g/cm3 |
| Punto di fusione |
56℃ |
| Punto di ebollizione |
340.3°C at 760 mmHg |
| Indice di rifrazione |
1.63 |
| Punto d'infiammabilità |
159.6°C |
| Pressione di vapore |
8.7E-05mmHg at 25°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
