ChemNet > CAS > 85684-64-6 2-(difluoromethoxy)benzyl bromide
85684-64-6 2-(difluoromethoxy)benzyl bromide
| Nome del prodotto |
2-(difluoromethoxy)benzyl bromide |
| Nome inglese |
2-(difluoromethoxy)benzyl bromide; alpha-Bromo-2-difluoromethoxytoluene; 1-(bromomethyl)-2-(difluoromethoxy)benzene |
| Formula molecolare |
C8H7BrF2O |
| Peso Molecolare |
237.0414 |
| InChI |
InChI=1/C8H7BrF2O/c9-5-6-3-1-2-4-7(6)12-8(10)11/h1-4,8H,5H2 |
| Numero CAS |
85684-64-6 |
| Struttura molecolare |
|
| Densità |
1.537g/cm3 |
| Punto di ebollizione |
225.2°C at 760 mmHg |
| Indice di rifrazione |
1.506 |
| Punto d'infiammabilità |
108.9°C |
| Pressione di vapore |
0.131mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
