ChemNet > CAS > 86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
| Nome del prodotto |
5-nitro-1-benzothiophene-2-carbonyl chloride |
| Nome inglese |
5-nitro-1-benzothiophene-2-carbonyl chloride; |
| Formula molecolare |
C9H4ClNO3S |
| Peso Molecolare |
241.651 |
| InChI |
InChI=1/C9H4ClNO3S/c10-9(12)8-4-5-3-6(11(13)14)1-2-7(5)15-8/h1-4H |
| Numero CAS |
86010-32-4 |
| Struttura molecolare |
|
| Densità |
1.597g/cm3 |
| Punto di fusione |
158℃ |
| Punto di ebollizione |
401.7°C at 760 mmHg |
| Indice di rifrazione |
1.712 |
| Punto d'infiammabilità |
196.7°C |
| Pressione di vapore |
1.16E-06mmHg at 25°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
