ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
| Nome del prodotto |
2-Chloro-6-fluoroacetophenone |
| Nome inglese |
2-Chloro-6-fluoroacetophenone;1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
| Formula molecolare |
C8H6ClFO |
| Peso Molecolare |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| Numero CAS |
87327-69-3 |
| Struttura molecolare |
|
| Densità |
1.258g/cm3 |
| Punto di ebollizione |
191.8°C at 760 mmHg |
| Indice di rifrazione |
1.512 |
| Punto d'infiammabilità |
69.8°C |
| Pressione di vapore |
0.506mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
