ChemNet > CAS > 874-66-8 2-Methyl-3-(2-furyl)propenal
874-66-8 2-Methyl-3-(2-furyl)propenal
| Nome del prodotto |
2-Methyl-3-(2-furyl)propenal |
| Nome inglese |
2-Methyl-3-(2-furyl)propenal; [2-Methyl-3-(2-furyl)acrolein]; 2-Methyl-3-(2-furyl)acrolein; 3-(2-Furanyl)-2-methyl-2-propenal; 3-(furan-2-yl)-2-methylprop-2-enal; (2E)-3-furan-2-yl-2-methylprop-2-enal; (2Z)-3-furan-2-yl-2-methylprop-2-enal; Cinnamon acrolein |
| Formula molecolare |
C8H8O2 |
| Peso Molecolare |
136.1479 |
| InChI |
InChI=1/C8H8O2/c1-7(6-9)5-8-3-2-4-10-8/h2-6H,1H3/b7-5- |
| Numero CAS |
874-66-8 |
| EINECS |
212-866-9 |
| Struttura molecolare |
|
| Densità |
1.073g/cm3 |
| Punto di ebollizione |
220.4°C at 760 mmHg |
| Indice di rifrazione |
1.528 |
| Punto d'infiammabilità |
93.1°C |
| Pressione di vapore |
0.113mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
