ChemNet > CAS > 90-26-6 2-Phenylbutyramide
90-26-6 2-Phenylbutyramide
| Nome del prodotto |
2-Phenylbutyramide |
| Nome inglese |
2-Phenylbutyramide;Phenylbutyramide; 2-Phenylbutanamide; 4-09-00-01818 (Beilstein Handbook Reference); AI3-01390; BRN 3197469; Butyramide, alpha-phenyl-; Eusterol; Geriapan; Geristerol; Hyposterol; Lipilisol; NSC 1861; Nivonorm; Normosterolo; Phenetamid; Phenetamide; Phenexan; Phenylethylacetamide; Redusterol; Substerina; TH 4128; alpha-Phenylbutyramide; alpha-Toluamide, alpha-ethyl-; Benzeneacetamide, alpha-ethyl- (9CI); Butyramide, 2-phenyl-; (2R)-2-phenylbutanamide; (2S)-2-phenylbutanamide |
| Formula molecolare |
C10H13NO |
| Peso Molecolare |
163.2163 |
| InChI |
InChI=1/C10H13NO/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H2,11,12)/t9-/m0/s1 |
| Numero CAS |
90-26-6 |
| EINECS |
201-980-4 |
| Struttura molecolare |
|
| Densità |
1.04g/cm3 |
| Punto di fusione |
83-86℃ |
| Punto di ebollizione |
316.8°C at 760 mmHg |
| Indice di rifrazione |
1.532 |
| Punto d'infiammabilità |
145.4°C |
| Pressione di vapore |
0.000402mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
