ChemNet > CAS > 90259-31-7 2-Bromo-6-methylbenzoic acid
90259-31-7 2-Bromo-6-methylbenzoic acid
| Nome del prodotto |
2-Bromo-6-methylbenzoic acid |
| Nome inglese |
2-Bromo-6-methylbenzoic acid; 6-Bromo-o-toluic acid |
| Formula molecolare |
C8H7BrO2 |
| Peso Molecolare |
215.044 |
| InChI |
InChI=1/C8H7BrO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| Numero CAS |
90259-31-7 |
| Struttura molecolare |
|
| Densità |
1.6g/cm3 |
| Punto di fusione |
108-112℃ |
| Punto di ebollizione |
307.043°C at 760 mmHg |
| Indice di rifrazione |
1.595 |
| Punto d'infiammabilità |
139.495°C |
| Pressione di vapore |
0mmHg at 25°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R22:;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
