ChemNet > CAS > 951-55-3 5-Methyl-DL-tryptophan
951-55-3 5-Methyl-DL-tryptophan
| Nome del prodotto |
5-Methyl-DL-tryptophan |
| Nome inglese |
5-Methyl-DL-tryptophan; |
| Formula molecolare |
C12H14N2O2 |
| Peso Molecolare |
218.2518 |
| InChI |
InChI=1/C12H14N2O2/c1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16/h2-4,6,10,14H,5,13H2,1H3,(H,15,16)/t10-/m1/s1 |
| Numero CAS |
951-55-3 |
| EINECS |
213-453-6 |
| Struttura molecolare |
|
| Densità |
1.313g/cm3 |
| Punto di fusione |
280-282℃ |
| Punto di ebollizione |
455.1°C at 760 mmHg |
| Indice di rifrazione |
1.677 |
| Punto d'infiammabilità |
229.1°C |
| Pressione di vapore |
4.48E-09mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
