ChemNet > CAS > 97914-59-5 2-(Difluoromethoxy)benzoic acid
97914-59-5 2-(Difluoromethoxy)benzoic acid
| Nome del prodotto |
2-(Difluoromethoxy)benzoic acid |
| Nome inglese |
2-(Difluoromethoxy)benzoic acid; 2-(Difluorometoxy)benzoic acid; 2-(difluoromethoxy)benzoate |
| Formula molecolare |
C8H6F2O3 |
| Peso Molecolare |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12) |
| Numero CAS |
97914-59-5 |
| Struttura molecolare |
|
| Densità |
1.37g/cm3 |
| Punto di ebollizione |
273.6°C at 760 mmHg |
| Indice di rifrazione |
1.496 |
| Punto d'infiammabilità |
119.3°C |
| Pressione di vapore |
0.00276mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
