ChemNet > CAS > 99-29-6 2-Bromo-6-chloro-4-nitroaniline
99-29-6 2-Bromo-6-chloro-4-nitroaniline
| Nome del prodotto |
2-Bromo-6-chloro-4-nitroaniline |
| Nome inglese |
2-Bromo-6-chloro-4-nitroaniline; Benzenamine, 2-bromo-6-chloro-4-nitro-; NSC 88985; Aniline, 2-bromo-6-chloro-4-nitro-; 2-Chloro-4-nitro-6-bromoaniline |
| Formula molecolare |
C6H4BrClN2O2 |
| Peso Molecolare |
251.4652 |
| InChI |
InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| Numero CAS |
99-29-6 |
| EINECS |
202-745-9 |
| Struttura molecolare |
|
| Densità |
1.909g/cm3 |
| Punto di ebollizione |
344.7°C at 760 mmHg |
| Indice di rifrazione |
1.677 |
| Punto d'infiammabilità |
162.3°C |
| Pressione di vapore |
6.47E-05mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
