ChemNet > CAS > 99-48-9;20307-86-2;22567-18-6 (-)-Carveol
99-48-9;20307-86-2;22567-18-6 (-)-Carveol
| Nome del prodotto |
(-)-Carveol |
| Nome inglese |
(-)-Carveol; p-Mentha-6,8-dien-2-ol; Carveol; 1-Methyl-4-isopropenyl-6-cyclohexen-2-ol; 2-06-00-00102 (Beilstein Handbook Reference); 2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)-; 2-Methyl-5-(1-methylethenyl)-2-cyclohexen-1-ol; 2-Methyl-5-isopropenyl-2-cyclohexen-1-ol; 5-Isopropenyl-2-methyl-2-cyclohexen-1-ol; AI3-27596; BRN 1861032; CCRIS 6219; EINECS 202-757-4; FEMA No. 2247; NSC 68313; UNII-1L9KXT85R9; p-Mentha-1,8-dien-6-ol; p-Mentha-1(6),8-dien-2-ol; 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol; (1S,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol; (1R,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol; (5R)-2-methyl-5-(1-methylethenyl)cyclohex-2-en-1-ol |
| Formula molecolare |
C10H16O |
| Peso Molecolare |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3/t9-,10?/m1/s1 |
| Numero CAS |
99-48-9;20307-86-2;22567-18-6 |
| EINECS |
202-757-4 |
| Struttura molecolare |
|
| Densità |
0.949g/cm3 |
| Punto di ebollizione |
231.5°C at 760 mmHg |
| Indice di rifrazione |
1.497 |
| Punto d'infiammabilità |
91.2°C |
| Pressione di vapore |
0.0117mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
