10047-28-6 butyl thioglycolate
상품명칭 |
butyl thioglycolate |
영문 이름 |
butyl thioglycolate; |
분자식 |
C6H12O2S |
분자량 |
148.2233 |
InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
cas번호 |
10047-28-6 |
EC번호 |
233-156-5 |
분자 구조 |
|
밀도 |
1.088g/cm3 |
비등점 |
220.125°C at 760 mmHg |
굴절 지수 |
1.491 |
인화점 |
86.929°C |
증기압 |
0.024mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|