10079-53-5;5344-78-5 4-bromo-3-nitroanisole
상품명칭 |
4-bromo-3-nitroanisole |
영문 이름 |
4-bromo-3-nitroanisole; 4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
분자식 |
C7H6BrNO3 |
분자량 |
232.0314 |
InChI |
InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
cas번호 |
10079-53-5;5344-78-5 |
EC번호 |
226-290-0 |
분자 구조 |
|
밀도 |
1.64g/cm3 |
녹는 점 |
32-34℃ |
비등점 |
291°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
123°C |
증기압 |
0.00349mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|