ChemNet > CAS > 100859-84-5 2-Chloro isonicotinamide
100859-84-5 2-Chloro isonicotinamide
상품명칭 |
2-Chloro isonicotinamide |
영문 이름 |
2-Chloro isonicotinamide;6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
분자식 |
C6H5ClN2O |
분자량 |
156.5697 |
InChI |
InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
cas번호 |
100859-84-5 |
분자 구조 |
|
밀도 |
1.381g/cm3 |
녹는 점 |
193℃ |
비등점 |
312.2°C at 760 mmHg |
굴절 지수 |
1.588 |
인화점 |
142.6°C |
증기압 |
0.000535mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|