ChemNet > CAS > 100959-19-1 4-Methylcyclohexylamine hydrochloride
100959-19-1 4-Methylcyclohexylamine hydrochloride
| 상품명칭 |
4-Methylcyclohexylamine hydrochloride |
| 영문 이름 |
4-Methylcyclohexylamine hydrochloride; 1-Amino-4-methylcyclohexane hydrochloride; 4-Methylcycohexylamine hydrochloride; 4-methylcyclohexanamine; 4-methylcyclohexanamine hydrochloride |
| 분자식 |
C7H16ClN |
| 분자량 |
149.6616 |
| InChI |
InChI=1/C7H15N.ClH/c1-6-2-4-7(8)5-3-6;/h6-7H,2-5,8H2,1H3;1H |
| cas번호 |
100959-19-1 |
| EC번호 |
228-673-8 |
| 분자 구조 |
|
| 비등점 |
195.9°C at 760 mmHg |
| 인화점 |
72.3°C |
| 증기압 |
0.347mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|