The physical and chemical property of 101-69-9 is provided by ChemNet.com
Chemical CAS Database with Global Chemical Suppliers - ChemNet


   ChemNet > CAS > 101-69-9 variamine blue B salt

101-69-9 variamine blue B salt

상품명칭 variamine blue B salt
영문 이름 variamine blue B salt; Variamine blue diazonium salt; 4-[(4-methoxyphenyl)amino]benzenediazonium chloride
분자식 C13H12ClN3O
분자량 261.7069
InChI InChI=1/C13H12N3O.ClH/c1-17-13-8-6-11(7-9-13)15-10-2-4-12(16-14)5-3-10;/h2-9,15H,1H3;1H/q+1;/p-1
cas번호 101-69-9
EC번호 202-967-6
분자 구조 101-69-9 variamine blue B salt
위험성 표시
리스크 규칙
보안 규칙