ChemNet > CAS > 1011-17-2 N-(2-Hydroxyphenyl)piperazine
1011-17-2 N-(2-Hydroxyphenyl)piperazine
상품명칭 |
N-(2-Hydroxyphenyl)piperazine |
영문 이름 |
N-(2-Hydroxyphenyl)piperazine; 1-(2-Hydroxyphenyl)piperazine; 2-(1-Piperazino)phenol; 2-(piperazin-1-yl)phenol; 4-(2-hydroxyphenyl)piperazin-1-ium; N-(2-Hydroxyphenyl) piperazine hcl |
분자식 |
C10H15N2O |
분자량 |
179.2384 |
InChI |
InChI=1/C10H14N2O/c13-10-4-2-1-3-9(10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2/p+1 |
cas번호 |
1011-17-2 |
EC번호 |
213-782-5 |
분자 구조 |
|
비등점 |
328.2°C at 760 mmHg |
인화점 |
152.3°C |
증기압 |
0.000101mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|