ChemNet > CAS > 1016-05-3 Dibenzothiophene sulfone
1016-05-3 Dibenzothiophene sulfone
상품명칭 |
Dibenzothiophene sulfone |
영문 이름 |
Dibenzothiophene sulfone; Dibenzothiophene-5,5-dioxide; dibenzo[b,d]thiophene 5,5-dioxide |
분자식 |
C12H8O2S |
분자량 |
216.2557 |
InChI |
InChI=1/C12H8O2S/c13-15(14)11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H |
cas번호 |
1016-05-3 |
EC번호 |
213-805-9 |
분자 구조 |
|
밀도 |
1.396g/cm3 |
녹는 점 |
231-236℃ |
비등점 |
422.2°C at 760 mmHg |
굴절 지수 |
1.675 |
인화점 |
275.7°C |
증기압 |
6.03E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|