ChemNet > CAS > 1019-52-9 3,5-Dinitro-4-hydroxybenzoic acid
1019-52-9 3,5-Dinitro-4-hydroxybenzoic acid
| 상품명칭 |
3,5-Dinitro-4-hydroxybenzoic acid |
| 영문 이름 |
3,5-Dinitro-4-hydroxybenzoic acid; 4-Hydroxy-3,5-dinitrobenzoic acid; 3,5-dinitro-4-oxidobenzoate |
| 분자식 |
C7H2N2O7 |
| 분자량 |
226.1011 |
| InChI |
InChI=1/C7H4N2O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H,(H,11,12)/p-2 |
| cas번호 |
1019-52-9 |
| EC번호 |
213-814-8 |
| 분자 구조 |
|
| 녹는 점 |
249-252℃ |
| 비등점 |
349.4°C at 760 mmHg |
| 인화점 |
155.7°C |
| 증기압 |
1.76E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
