102-38-5 3-Nitroformanilide
상품명칭 |
3-Nitroformanilide |
영문 이름 |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
분자식 |
C7H6N2O3 |
분자량 |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
cas번호 |
102-38-5 |
분자 구조 |
|
밀도 |
1.407g/cm3 |
비등점 |
368.5°C at 760 mmHg |
굴절 지수 |
1.641 |
인화점 |
176.7°C |
증기압 |
1.27E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|