ChemNet > CAS > 102-39-6 m-phenylenedioxydi(acetic acid)
102-39-6 m-phenylenedioxydi(acetic acid)
상품명칭 |
m-phenylenedioxydi(acetic acid) |
영문 이름 |
m-phenylenedioxydi(acetic acid); Resorcinol-O,O-diacetic acid; 1,3-Bis(carboxymethoxy)benzene; Resorcinol-O,O-diacetic acid; 2,2'-[benzene-1,3-diylbis(oxy)]diacetic acid |
분자식 |
C10H10O6 |
분자량 |
226.1828 |
InChI |
InChI=1/C10H10O6/c11-9(12)5-15-7-2-1-3-8(4-7)16-6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14) |
cas번호 |
102-39-6 |
EC번호 |
203-027-8 |
분자 구조 |
|
밀도 |
1.416g/cm3 |
비등점 |
447.4°C at 760 mmHg |
굴절 지수 |
1.564 |
인화점 |
180.4°C |
증기압 |
8.65E-09mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|