102-85-2 Tributyl phosphite
상품명칭 |
Tributyl phosphite |
영문 이름 |
Tributyl phosphite; Tri-n-butyl phosphite |
분자식 |
C12H27O3P |
분자량 |
250.3147 |
InChI |
InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
cas번호 |
102-85-2 |
EC번호 |
203-061-3 |
분자 구조 |
|
녹는 점 |
-80℃ |
비등점 |
268.1°C at 760 mmHg |
인화점 |
121.1°C |
증기압 |
0.013mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R21:Harmful in contact with skin.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|