ChemNet > CAS > 10203-58-4 Diethyl isobutylmalonate
10203-58-4 Diethyl isobutylmalonate
| 상품명칭 |
Diethyl isobutylmalonate |
| 영문 이름 |
Diethyl isobutylmalonate;Propanedioic acid, 2-(2-methylpropyl)-, 1,3-diethyl ester; AI3-05627; Malonic acid, isobutyl-, diethyl ester; NSC 68522; Propanedioic acid, (2-methylpropyl)-, diethyl ester; diethyl (2-methylpropyl)propanedioate; Isobutylmalonic Acid Diethyl Ester |
| 분자식 |
C11H20O4 |
| 분자량 |
216.2741 |
| InChI |
InChI=1/C11H20O4/c1-5-14-10(12)9(7-8(3)4)11(13)15-6-2/h8-9H,5-7H2,1-4H3 |
| cas번호 |
10203-58-4 |
| EC번호 |
233-504-6 |
| 분자 구조 |
|
| 밀도 |
0.992g/cm3 |
| 비등점 |
255°C at 760 mmHg |
| 굴절 지수 |
1.431 |
| 인화점 |
103.1°C |
| 증기압 |
0.0167mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
