ChemNet > CAS > 10224-72-3 Dimethyl 1,1-cyclobutanedicarboxylate
10224-72-3 Dimethyl 1,1-cyclobutanedicarboxylate
상품명칭 |
Dimethyl 1,1-cyclobutanedicarboxylate |
영문 이름 |
Dimethyl 1,1-cyclobutanedicarboxylate; 1,1-Cyclobutanedicarboxylic acid dimethyl ester; Dimethyl1,1-cyclobutanedicarboxylate, (1,1-Cyclobutanedicarboxylicacid dimethylester); dimethyl cyclobutane-1,1-dicarboxylate |
분자식 |
C8H12O4 |
분자량 |
172.1785 |
InChI |
InChI=1/C8H12O4/c1-11-6(9)8(4-3-5-8)7(10)12-2/h3-5H2,1-2H3 |
cas번호 |
10224-72-3 |
분자 구조 |
|
밀도 |
1.19g/cm3 |
비등점 |
182.6°C at 760 mmHg |
굴절 지수 |
1.468 |
인화점 |
79.5°C |
증기압 |
0.806mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|