ChemNet > CAS > 10241-97-1 5-methylindole-2-carboxylic acid
10241-97-1 5-methylindole-2-carboxylic acid
상품명칭 |
5-methylindole-2-carboxylic acid |
영문 이름 |
5-methylindole-2-carboxylic acid; 5-methyl-1H-indole-2-carboxylic acid |
분자식 |
C10H9NO2 |
분자량 |
175.184 |
InChI |
InChI=1/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13) |
cas번호 |
10241-97-1 |
분자 구조 |
|
밀도 |
1.34g/cm3 |
비등점 |
421.2°C at 760 mmHg |
굴절 지수 |
1.696 |
인화점 |
208.5°C |
증기압 |
7.58E-08mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|