103-94-6 4-Nitrophenyloxamic acid

상품명칭	4-Nitrophenyloxamic acid
영문 이름	4-Nitrophenyloxamic acid; 4-Nitrooxanilic acid; [(4-nitrophenyl)amino](oxo)acetic acid
분자식	C₈H₆N₂O₅
분자량	210.1436
InChI	InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13)
cas번호	103-94-6
EC번호	203-160-1
분자 구조
밀도	1.629g/cm³
굴절 지수	1.678
위험성 표시
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;