ChemNet > CAS > 10323-20-3;28697-53-2 D(-)-Arabinose
10323-20-3;28697-53-2 D(-)-Arabinose
상품명칭 |
D(-)-Arabinose |
영문 이름 |
D(-)-Arabinose; Arabinose(D); D-(-)-Arabinose; D-arabinopyranose; beta-L-arabinopyranose; .beta.-D-Arabinopyranose; beta-D-arabinopyranose; alpha-D-arabinopyranose; D-Arabinose; pectinose; Pectin sugar; beta-D-(-)-Arabinose |
분자식 |
C5H10O5 |
분자량 |
150.1299 |
InChI |
InChI=1/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5-/m0/s1 |
cas번호 |
10323-20-3;28697-53-2 |
EC번호 |
233-708-5 |
분자 구조 |
|
밀도 |
1.757g/cm3 |
녹는 점 |
152-160℃ |
비등점 |
333.2°C at 760 mmHg |
굴절 지수 |
1.646 |
인화점 |
155.3°C |
증기압 |
9.92E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|