10443-65-9 2-bromoacrylic acid
상품명칭 |
2-bromoacrylic acid |
영문 이름 |
2-bromoacrylic acid;2-Bromoacrylic acid; CCRIS 5478; NSC 227848; 2-bromoprop-2-enoic acid; 2-bromoprop-2-enoate |
분자식 |
C3H2BrO2 |
분자량 |
149.9513 |
InChI |
InChI=1/C3H3BrO2/c1-2(4)3(5)6/h1H2,(H,5,6)/p-1 |
cas번호 |
10443-65-9 |
EC번호 |
233-928-1 |
분자 구조 |
|
녹는 점 |
62-65℃ |
비등점 |
224.5°C at 760 mmHg |
인화점 |
89.6°C |
증기압 |
0.0333mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
R43:May cause sensitization by skin contact.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|