ChemNet > CAS > 104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
상품명칭 |
2-Chloro-6-fluoro-3-methylbenzaldehyde |
영문 이름 |
2-Chloro-6-fluoro-3-methylbenzaldehyde; 2-Chloro-6-fluoro-m-tolualdehyde |
분자식 |
C8H6ClFO |
분자량 |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-4H,1H3 |
cas번호 |
104451-99-2 |
분자 구조 |
|
밀도 |
1.292g/cm3 |
녹는 점 |
30-33℃ |
비등점 |
225.1°C at 760 mmHg |
굴절 지수 |
1.552 |
인화점 |
89.9°C |
증기압 |
0.0882mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|