ChemNet > CAS > 104776-74-1 ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate
104776-74-1 ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate
상품명칭 |
ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate |
영문 이름 |
ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate;ethyl 5-(bromoacetyl)isoxazole-3-carboxylate |
분자식 |
C8H8BrNO4 |
분자량 |
262.0574 |
InChI |
InChI=1/C8H8BrNO4/c1-2-13-8(12)5-3-7(14-10-5)6(11)4-9/h3H,2,4H2,1H3 |
cas번호 |
104776-74-1 |
분자 구조 |
|
밀도 |
1.592g/cm3 |
녹는 점 |
71℃ |
비등점 |
374.2°C at 760 mmHg |
굴절 지수 |
1.529 |
인화점 |
180.1°C |
증기압 |
8.52E-06mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|