10487-71-5 Crotonyl chloride
상품명칭 |
Crotonyl chloride |
영문 이름 |
Crotonyl chloride; 2-Butenoyl chloride; But-2-enoyl chloride |
분자식 |
C4H5ClO |
분자량 |
104.5349 |
InChI |
InChI=1/C4H5ClO/c1-2-3-4(5)6/h2-3H,1H3/b3-2- |
cas번호 |
10487-71-5 |
EC번호 |
234-010-3 |
분자 구조 |
|
밀도 |
1.081g/cm3 |
비등점 |
124.499°C at 760 mmHg |
굴절 지수 |
1.441 |
인화점 |
35°C |
증기압 |
12.707mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R10:Flammable.;
R34:Causes burns.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|