105-05-5 1,4-Diethylbenzene
상품명칭 |
1,4-Diethylbenzene |
영문 이름 |
1,4-Diethylbenzene; Benzene, 1,4-diethyl-; Benzene, p-diethyl-; HSDB 4083; p-Diethylbenzene; p-Ethylethylbenzene; butan-2-ylbenzene; PDEB |
분자식 |
C10H14 |
분자량 |
134.2182 |
InChI |
InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
cas번호 |
105-05-5 |
EC번호 |
203-265-2 |
분자 구조 |
|
밀도 |
0.86g/cm3 |
녹는 점 |
-43℃ |
비등점 |
173.3°C at 760 mmHg |
굴절 지수 |
1.489 |
인화점 |
46.3°C |
증기압 |
1.7mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|