ChemNet > CAS > 10516-71-9 3-(3-methoxyphenyl)propionic acid
10516-71-9 3-(3-methoxyphenyl)propionic acid
| 상품명칭 |
3-(3-methoxyphenyl)propionic acid |
| 영문 이름 |
3-(3-methoxyphenyl)propionic acid; 3-Methoxyhydrocinnamic acid; 3-(3-methoxyphenyl)propanoic acid |
| 분자식 |
C10H12O3 |
| 분자량 |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| cas번호 |
10516-71-9 |
| EC번호 |
234-049-6 |
| 분자 구조 |
|
| 밀도 |
1.144g/cm3 |
| 녹는 점 |
43-45℃ |
| 비등점 |
318.1°C at 760 mmHg |
| 굴절 지수 |
1.53 |
| 인화점 |
125.6°C |
| 증기압 |
0.000155mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
