ChemNet > CAS > 10595-06-9 2-Phenoxyethyl methacrylate
10595-06-9 2-Phenoxyethyl methacrylate
| 상품명칭 |
2-Phenoxyethyl methacrylate |
| 영문 이름 |
2-Phenoxyethyl methacrylate; |
| 분자식 |
C12H14O3 |
| 분자량 |
206.2378 |
| InChI |
InChI=1/C12H14O3/c1-9(2)12(13)15-10(3)14-11-7-5-4-6-8-11/h4-8,10H,1H2,2-3H3 |
| cas번호 |
10595-06-9 |
| EC번호 |
234-201-1 |
| 분자 구조 |
|
| 밀도 |
1.059g/cm3 |
| 비등점 |
292.352°C at 760 mmHg |
| 굴절 지수 |
1.501 |
| 인화점 |
118.277°C |
| 증기압 |
0.002mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
