106-42-3 p-Xylene
상품명칭 |
p-Xylene |
영문 이름 |
p-Xylene; 1,4-Dimethylbenzene; para-xylene; Dibencoside; 1,4-xylene |
분자식 |
C8H10 |
분자량 |
106.1674 |
InChI |
InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
cas번호 |
106-42-3 |
EC번호 |
203-396-5 |
분자 구조 |
|
녹는 점 |
13-13℃ |
비등점 |
139.61°C at 760 mmHg |
인화점 |
24.627°C |
증기압 |
7.943mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R38:Irritating to skin.;
|
보안 규칙 |
S25:Avoid contact with eyes.;
|
|