106-57-0 Glycine anhydride
상품명칭 |
Glycine anhydride |
영문 이름 |
Glycine anhydride; 2,5-Diketopiperazine; 2,5-Piperazinedione,(Glycine anhydride); Dioxo Piperazine; Cyclo(-Gly-Gly); 2,5-Piperazinedione; piperazine-2,5-dione; piperazine-2,3-dione |
분자식 |
C4H6N2O2 |
분자량 |
114.1026 |
InChI |
InChI=1/C4H6N2O2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8) |
cas번호 |
106-57-0 |
EC번호 |
203-411-5 |
분자 구조 |
|
밀도 |
1.246g/cm3 |
녹는 점 |
300℃ |
굴절 지수 |
1.467 |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|