1066-38-2 트리메틸 요오드게르마네
| 상품명칭 |
트리메틸 요오드게르마네 |
| 별명 |
; 트리메틸게르마늄 요오드화물; 요오드트리메틸게르마네; 트리메틸게르마닐륨 요오드화물 |
| 영문 이름 |
Trimethyliodogermane; Trimethylgermanium iodide; Iodotrimethylgermane; trimethylgermanylium iodide |
| 분자식 |
C3H9GeI |
| 분자량 |
244.648 |
| InChI |
InChI=1/C3H9Ge.HI/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| cas번호 |
1066-38-2 |
| 분자 구조 |
|
| 위험성 표시 |
T:Toxic;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
R61:May cause harm to the unborn child.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|