ChemNet > CAS > 1070-10-6 Titanium 2-ethylhexoxide
1070-10-6 Titanium 2-ethylhexoxide
상품명칭 |
Titanium 2-ethylhexoxide |
영문 이름 |
Titanium 2-ethylhexoxide; Tetrakis(2-ethylhexyl) orthotitanate; Tetrakis(2-ethylhexyl)titanium(IV); Tetraoctyl orthotitanate; Titanium (IV) 2-ethylhexoxide; Titanium ethylhexoxide; Titanium(IV) 2-ethylhexyloxide; Titanium tetra-2-ethylhexoxide; Tetra-2-ethylhexyl titanate; Tetratitanate(2-ethyl hexanol); Titaniumtetraki(2-ethyl hexanolate); Titaniumtetra(2-ethylhexoxide) |
분자식 |
C32H68O4Ti |
분자량 |
564.75 |
InChI |
InChI=1/C8H18O.Ti/c1-3-5-6-8(4-2)7-9;/h8-9H,3-7H2,1-2H3;/q;+4 |
cas번호 |
1070-10-6 |
EC번호 |
213-969-1 |
분자 구조 |
|
밀도 |
0.927 g/mL at 25 °C(lit.) |
녹는 점 |
熔点:18-20°C |
비등점 |
248-249 °C11 mm Hg(lit.) |
굴절 지수 |
n20/D 1.479(lit.) |
인화점 |
160 °F |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|