ChemNet > CAS > 107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride
107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride
상품명칭 |
2,3,5,6-Tetrafluorobenzoyl chloride |
영문 이름 |
2,3,5,6-Tetrafluorobenzoyl chloride; |
분자식 |
C7HClF4O |
분자량 |
212.5289 |
InChI |
InChI=1/C7HClF4O/c8-7(13)4-5(11)2(9)1-3(10)6(4)12/h1H |
cas번호 |
107535-73-9 |
분자 구조 |
|
밀도 |
1.601g/cm3 |
비등점 |
172.1°C at 760 mmHg |
굴절 지수 |
1.461 |
인화점 |
57.9°C |
증기압 |
1.35mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|