ChemNet > CAS > 1076-74-0 5-Methoxy-2-methylindole
1076-74-0 5-Methoxy-2-methylindole
상품명칭 |
5-Methoxy-2-methylindole |
영문 이름 |
5-Methoxy-2-methylindole;5-methoxy-2-methyl-1H-indole |
분자식 |
C10H11NO |
분자량 |
161.2004 |
InChI |
InChI=1/C10H11NO/c1-7-5-8-6-9(12-2)3-4-10(8)11-7/h3-6,11H,1-2H3 |
cas번호 |
1076-74-0 |
EC번호 |
214-066-5 |
분자 구조 |
|
밀도 |
1.134g/cm3 |
녹는 점 |
85-88℃ |
비등점 |
308.5°C at 760 mmHg |
굴절 지수 |
1.621 |
인화점 |
113.1°C |
증기압 |
0.00123mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|