ChemNet > CAS > 108078-14-4 2-Iodo-3-methylbenzoic acid
108078-14-4 2-Iodo-3-methylbenzoic acid
상품명칭 |
2-Iodo-3-methylbenzoic acid |
영문 이름 |
2-Iodo-3-methylbenzoic acid; 2-Iodo-m-toluic acid |
분자식 |
C8H7IO2 |
분자량 |
262.0444 |
InChI |
InChI=1/C8H7IO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,1H3,(H,10,11) |
cas번호 |
108078-14-4 |
분자 구조 |
|
밀도 |
1.867g/cm3 |
비등점 |
323.5°C at 760 mmHg |
굴절 지수 |
1.645 |
인화점 |
149.5°C |
증기압 |
0.000107mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|