ChemNet > CAS > 108124-17-0 2-Methyl-5-phenylfuran-3-carboxylic acid
108124-17-0 2-Methyl-5-phenylfuran-3-carboxylic acid
상품명칭 |
2-Methyl-5-phenylfuran-3-carboxylic acid |
영문 이름 |
2-Methyl-5-phenylfuran-3-carboxylic acid; 2-Methyl-5-phenyl-3-furoic acid; 2-methyl-5-phenylfuran-3-carboxylate |
분자식 |
C12H9O3 |
분자량 |
201.1986 |
InChI |
InChI=1/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)/p-1 |
cas번호 |
108124-17-0 |
분자 구조 |
|
녹는 점 |
176-179℃ |
비등점 |
357.1°C at 760 mmHg |
인화점 |
169.8°C |
증기압 |
1.01E-05mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|